cas: 1235440-96-6 — see every product listed under this CAS number, including other names
Sodium 1,3–thiazole–4–carboxylate (CAS 1235440-96-6) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 10g, 1g, 2,5g, 250mg, 500mg, 5g. Offered by: GLPBio.
| brand | GLPBio |
|---|---|
| catalog number | GB60928-100 |
| cas | 1235440-96-6 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| GLPBio | 100mg | 704.69 Pln | |
| GLPBio | 10g | 2941.97 Pln | |
| GLPBio | 1g | 770.22 Pln | |
| GLPBio | 2,5g | 1107.21 Pln | |
| GLPBio | 250mg | 718.73 Pln | |
| GLPBio | 500mg | 728.09 Pln | |
| GLPBio | 5g | 1781.21 Pln |
| purity | No data |
|---|---|
| delivery time | To be confirmed by Chemat |
Sodium 1,3-thiazole-4-carboxylate (CAS 1235440-96-6) is a chemical compound with the molecular formula C4H2NNaO2S and a molecular weight of 151.12 g/mol. IUPAC name: sodium 1,3-thiazole-4-carboxylate. InChIKey: ZSROCMPMLGILQG-UHFFFAOYSA-M.
| Molecular formula | C4H2NNaO2S |
|---|---|
| Molecular weight | 151.12 g/mol |
| IUPAC name | sodium 1,3-thiazole-4-carboxylate |
| InChIKey | ZSROCMPMLGILQG-UHFFFAOYSA-M |
| SMILES | C1=C(N=CS1)C(=O)[O-].[Na+] |
Computed by PubChem (NCBI)