CAS 497097-92-4 appears in our catalog under these names: Sodium thiazole–2–carboxylate, Sodium thiazole-2-carboxylate 95+%, Sodium thiazole-2-carboxylate, 95+%, 95+%. Offered by: GLPBio, Ambeed, Chemat. Available pack sizes: 100g, 10g, 1g, 2,5g, 25g, 500mg, 50g, 5g.
Sodium 1,3-thiazole-2-carboxylate (CAS 497097-92-4) is a chemical compound with the molecular formula C4H2NNaO2S and a molecular weight of 151.12 g/mol. IUPAC name: sodium 1,3-thiazole-2-carboxylate. InChIKey: HPPZVDKRGXYZEF-UHFFFAOYSA-M.
| Molecular formula | C4H2NNaO2S |
|---|---|
| Molecular weight | 151.12 g/mol |
| IUPAC name | sodium 1,3-thiazole-2-carboxylate |
| InChIKey | HPPZVDKRGXYZEF-UHFFFAOYSA-M |
| SMILES | C1=CSC(=N1)C(=O)[O-].[Na+] |
Computed by PubChem (NCBI)