CAS 1235440-96-6 appears in our catalog under these names: Sodium 1,3-thiazole-4-carboxylate, 95%, Sodium 1,3–thiazole–4–carboxylate, Sodium 1,3-thiazole-4-carboxylate. Offered by: Combi-blocks, GLPBio, Biosynth. Available pack sizes: 10g, 1g, 5g, 100mg, 2,5g, 250mg, 500mg, 50g.
Sodium 1,3-thiazole-4-carboxylate (CAS 1235440-96-6) is a chemical compound with the molecular formula C4H2NNaO2S and a molecular weight of 151.12 g/mol. IUPAC name: sodium 1,3-thiazole-4-carboxylate. InChIKey: ZSROCMPMLGILQG-UHFFFAOYSA-M.
| Molecular formula | C4H2NNaO2S |
|---|---|
| Molecular weight | 151.12 g/mol |
| IUPAC name | sodium 1,3-thiazole-4-carboxylate |
| InChIKey | ZSROCMPMLGILQG-UHFFFAOYSA-M |
| SMILES | C1=C(N=CS1)C(=O)[O-].[Na+] |
Computed by PubChem (NCBI)