CAS 26862-80-6 is the registry number for Sodium 1,3-thiazole-5-carboxylate, 95%. Offered by: Combi-blocks. Available pack sizes: 10g, 1g, 5g.
Sodium 1,3-thiazole-5-carboxylate (CAS 26862-80-6) is a chemical compound with the molecular formula C4H2NNaO2S and a molecular weight of 151.12 g/mol. IUPAC name: sodium 1,3-thiazole-5-carboxylate. InChIKey: UJBRAHHFSPRLBT-UHFFFAOYSA-M.
| Molecular formula | C4H2NNaO2S |
|---|---|
| Molecular weight | 151.12 g/mol |
| IUPAC name | sodium 1,3-thiazole-5-carboxylate |
| InChIKey | UJBRAHHFSPRLBT-UHFFFAOYSA-M |
| SMILES | C1=C(SC=N1)C(=O)[O-].[Na+] |
Computed by PubChem (NCBI)