cas: 1236862-45-5 — see every product listed under this CAS number, including other names
Spiro(azetidine-3,2'-(2H-1)benzopyran)-4'(3'H)-one, hydrochloride, 98% (CAS 1236862-45-5) is a chemical reagent available from Chemat. Available pack sizes: 10g, 5g. Offered by: AmBeed.
| brand | AmBeed |
|---|---|
| catalog number | A1153302-10g |
| cas | 1236862-45-5 |
| size | 10g |
| availability | Synthetic Items: 0g |
| brand | size | price | |
|---|---|---|---|
| AmBeed | 10g | 27913.27 Pln | |
| AmBeed | 5g | 19958.05 Pln |
| purity | 98% |
|---|---|
| delivery time | To be confirmed by Chemat |
Spiro[3H-chromene-2,3'-azetidine]-4-one;hydrochloride (CAS 1236862-45-5) is a chemical compound with the molecular formula C11H12ClNO2 and a molecular weight of 225.67 g/mol. IUPAC name: spiro[3H-chromene-2,3'-azetidine]-4-one;hydrochloride. InChIKey: TYWUOQGJIFWZDU-UHFFFAOYSA-N.
| Molecular formula | C11H12ClNO2 |
|---|---|
| Molecular weight | 225.67 g/mol |
| IUPAC name | spiro[3H-chromene-2,3'-azetidine]-4-one;hydrochloride |
| InChIKey | TYWUOQGJIFWZDU-UHFFFAOYSA-N |
| SMILES | C1C(=O)C2=CC=CC=C2OC13CNC3.Cl |
Computed by PubChem (NCBI)