cas: 753440-87-8 — see every product listed under this CAS number, including other names
Spiro(piperidine-4,4'-pyrido(2,3-d)(1,3)oxazin)-2'(1'H)-one, 97% (CAS 753440-87-8) is a chemical reagent available from Chemat. Available pack sizes: 5g, 10g. Offered by: AmBeed.
| brand | AmBeed |
|---|---|
| catalog number | A137230-5g |
| cas | 753440-87-8 |
| size | 5g |
| availability | Synthetic Items: 0g |
| brand | size | price | |
|---|---|---|---|
| AmBeed | 5g | 11495.05 Pln | |
| AmBeed | 10g | 19111.75 Pln |
| purity | 97% |
|---|---|
| delivery time | To be confirmed by Chemat |
Spiro[1H-pyrido[2,3-d][1,3]oxazine-4,4'-piperidine]-2-one (CAS 753440-87-8) is a chemical compound with the molecular formula C11H13N3O2 and a molecular weight of 219.24 g/mol. IUPAC name: spiro[1H-pyrido[2,3-d][1,3]oxazine-4,4'-piperidine]-2-one. InChIKey: HNGKYJPFWVQZSF-UHFFFAOYSA-N.
| Molecular formula | C11H13N3O2 |
|---|---|
| Molecular weight | 219.24 g/mol |
| IUPAC name | spiro[1H-pyrido[2,3-d][1,3]oxazine-4,4'-piperidine]-2-one |
| InChIKey | HNGKYJPFWVQZSF-UHFFFAOYSA-N |
| SMILES | C1CNCCC12C3=C(NC(=O)O2)N=CC=C3 |
Computed by PubChem (NCBI)