Spiro[azetidine-3,1''(3''H)-isobenzofuran]-1-carboxylic acid, 5''-bromo-, 1,1-dimethylethyl ester, 97%, 97%
cas: 1398609-80-7 — see every product listed under this CAS number, including other names
Spiro[azetidine-3,1''(3''H)-isobenzofuran]-1-carboxylic acid, 5''-bromo-, 1,1-dimethylethyl ester, 97%, 97% (CAS 1398609-80-7) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 500mg, 1g, 5g, 10g, 25g, 100g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch112BR3-250mg |
| cas | 1398609-80-7 |
| size | 250mg |
| availability | 300g |
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Chemat | 250mg | 165.20 Pln | |
| Chemat | 500mg | 237.20 Pln | |
| Chemat | 1g | 294.80 Pln | |
| Chemat | 5g | 813.20 Pln | |
| Chemat | 10g | 1336.40 Pln | |
| Chemat | 25g | 2613.20 Pln | |
| Chemat | 100g | 8234.00 Pln |
properties
| purity | 97% |
|---|---|
| delivery time | 3 weeks |
Tert-butyl 6-bromospiro[1H-2-benzofuran-3,3'-azetidine]-1'-carboxylate (CAS 1398609-80-7) is a chemical compound with the molecular formula C15H18BrNO3 and a molecular weight of 340.21 g/mol. IUPAC name: tert-butyl 6-bromospiro[1H-2-benzofuran-3,3'-azetidine]-1'-carboxylate. InChIKey: OKUKFGKSJZBSBP-UHFFFAOYSA-N.
| Molecular formula | C15H18BrNO3 |
|---|---|
| Molecular weight | 340.21 g/mol |
| IUPAC name | tert-butyl 6-bromospiro[1H-2-benzofuran-3,3'-azetidine]-1'-carboxylate |
| InChIKey | OKUKFGKSJZBSBP-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)N1CC2(C1)C3=C(CO2)C=C(C=C3)Br |
Computed by PubChem (NCBI)
Synonyms:
tert-Butyl 5'-bromo-3'h-spiro(azetidine-3,1'-isobenzofuran)-1-carboxylate, tert-butyl 5'-bromo-3'H-spiro[azetidine-3,1'-[2]benzofuran]-1-carboxylate, tert-butyl 6-bromospiro[1H-2-benzofuran-3,3'-azetidine]-1'-carboxylate, tert-Butyl 6-bromospiro[1H-isobenzofuran-3,3'-azetidine]-1'-carboxylate, OKUKFGKSJZBSBP-UHFFFAOYSA-N, 1-Boc-5'-Bromo-3'H-spiro[azetidine-3,1'-[2]benzofuran]