Products 2241725-11-9
CAS 2241725-11-9 is the registry number for tert-Butyl (R)-5-bromo-3-formyl-3,4-dihydroisoquinoline-2(1H)-carboxylate, 98%. Offered by: Chemat Brand, Fluorochem. Available pack sizes: on request, 100mg, 250mg.
Tert-butyl (3R)-5-bromo-3-formyl-3,4-dihydro-1H-isoquinoline-2-carboxylate (CAS 2241725-11-9) is a chemical compound with the molecular formula C15H18BrNO3 and a molecular weight of 340.21 g/mol. IUPAC name: tert-butyl (3R)-5-bromo-3-formyl-3,4-dihydro-1H-isoquinoline-2-carboxylate. InChIKey: FIKBBTUQYLWWBE-LLVKDONJSA-N.
| Molecular formula | C15H18BrNO3 |
|---|---|
| Molecular weight | 340.21 g/mol |
| IUPAC name | tert-butyl (3R)-5-bromo-3-formyl-3,4-dihydro-1H-isoquinoline-2-carboxylate |
| InChIKey | FIKBBTUQYLWWBE-LLVKDONJSA-N |
| SMILES | CC(C)(C)OC(=O)N1CC2=C(C[C@@H]1C=O)C(=CC=C2)Br |
Computed by PubChem (NCBI)