CAS 1428243-39-3 is the registry number for Benzyl (3R,4S)-3-(2-bromoacetyl)-4-methylpyrrolidine-1-carboxylate, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
Benzyl (3R,4S)-3-(2-bromoacetyl)-4-methylpyrrolidine-1-carboxylate (CAS 1428243-39-3) is a chemical compound with the molecular formula C15H18BrNO3 and a molecular weight of 340.21 g/mol. IUPAC name: benzyl (3R,4S)-3-(2-bromoacetyl)-4-methylpyrrolidine-1-carboxylate. InChIKey: MJGSAOUFEUFZKQ-YPMHNXCESA-N.
| Molecular formula | C15H18BrNO3 |
|---|---|
| Molecular weight | 340.21 g/mol |
| IUPAC name | benzyl (3R,4S)-3-(2-bromoacetyl)-4-methylpyrrolidine-1-carboxylate |
| InChIKey | MJGSAOUFEUFZKQ-YPMHNXCESA-N |
| SMILES | C[C@@H]1CN(C[C@@H]1C(=O)CBr)C(=O)OCC2=CC=CC=C2 |
Computed by PubChem (NCBI)