CAS 1817672-32-4 is the registry number for tert-Butyl 5-bromo-1,1-dimethyl-3-oxoisoindoline-2-carboxylate, 98%. Offered by: AmBeed. Available pack sizes: 5g, 10g, 1g.
Tert-butyl 5-bromo-1,1-dimethyl-3-oxoisoindole-2-carboxylate (CAS 1817672-32-4) is a chemical compound with the molecular formula C15H18BrNO3 and a molecular weight of 340.21 g/mol. IUPAC name: tert-butyl 5-bromo-1,1-dimethyl-3-oxoisoindole-2-carboxylate. InChIKey: QMMQKDHAUISGBK-UHFFFAOYSA-N.
| Molecular formula | C15H18BrNO3 |
|---|---|
| Molecular weight | 340.21 g/mol |
| IUPAC name | tert-butyl 5-bromo-1,1-dimethyl-3-oxoisoindole-2-carboxylate |
| InChIKey | QMMQKDHAUISGBK-UHFFFAOYSA-N |
| SMILES | CC1(C2=C(C=C(C=C2)Br)C(=O)N1C(=O)OC(C)(C)C)C |
Computed by PubChem (NCBI)