CAS 122-06-5 appears in our catalog under these names: Stilbamidine (Ba 2652), Stilbamidine/ 97.97% (existing batch purity), Stilbamidine. Offered by: GLPBio, TargetMol, Chemat, MedChemExpress. Available pack sizes: 5mg, 1mg, 10mg, 25mg, 50mg, 20mg, 2mg, Get quote.
4-[(E)-2-(4-carbamimidoylphenyl)ethenyl]benzenecarboximidamide (CAS 122-06-5) is a chemical compound with the molecular formula C16H16N4 and a molecular weight of 264.32 g/mol. IUPAC name: 4-[(E)-2-(4-carbamimidoylphenyl)ethenyl]benzenecarboximidamide. InChIKey: MMURVNDSFNJHAM-OWOJBTEDSA-N.
| Molecular formula | C16H16N4 |
|---|---|
| Molecular weight | 264.32 g/mol |
| IUPAC name | 4-[(E)-2-(4-carbamimidoylphenyl)ethenyl]benzenecarboximidamide |
| InChIKey | MMURVNDSFNJHAM-OWOJBTEDSA-N |
| SMILES | C1=CC(=CC=C1/C=C/C2=CC=C(C=C2)C(=N)N)C(=N)N |
Computed by PubChem (NCBI)