cas: 22731-83-5 — see every product listed under this CAS number, including other names
Sulfonimidoyldibenzene, 97%, 97% (CAS 22731-83-5) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g, 25g, 100mg. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch11IXLV-250mg |
| cas | 22731-83-5 |
| size | 250mg |
| availability | 125g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 250mg | 102.80 Pln | |
| Chemat | 1g | 184.40 Pln | |
| Chemat | 5g | 563.60 Pln | |
| Chemat | 25g | 2013.20 Pln | |
| Chemat | 100mg | 88.40 Pln |
| purity | 97% |
|---|---|
| delivery time | 3 weeks |
Imino-oxo-diphenyl-lambda6-sulfane (CAS 22731-83-5) is a chemical compound with the molecular formula C12H11NOS and a molecular weight of 217.29 g/mol. IUPAC name: imino-oxo-diphenyl-lambda6-sulfane. InChIKey: KNPJTNDEHOFWKA-UHFFFAOYSA-N.
| Molecular formula | C12H11NOS |
|---|---|
| Molecular weight | 217.29 g/mol |
| IUPAC name | imino-oxo-diphenyl-lambda6-sulfane |
| InChIKey | KNPJTNDEHOFWKA-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)S(=N)(=O)C2=CC=CC=C2 |
Computed by PubChem (NCBI)