cas: 1251010-17-9 — see every product listed under this CAS number, including other names
TERT-BUTYL 1-OXO-6-AZASPIRO[3.4]OCTANE-6-CARBOXYLATE, 97%, 97% (CAS 1251010-17-9) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 500mg, 1g, 5g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch111N7Q-100mg |
| cas | 1251010-17-9 |
| size | 100mg |
| availability | 5g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 813.20 Pln | |
| Chemat | 250mg | 1187.60 Pln | |
| Chemat | 500mg | 1936.40 Pln | |
| Chemat | 1g | 3213.20 Pln | |
| Chemat | 5g | 11205.20 Pln |
| purity | 97% |
|---|---|
| delivery time | 3 weeks |
Tert-butyl 3-oxo-6-azaspiro[3.4]octane-6-carboxylate (CAS 1251010-17-9) is a chemical compound with the molecular formula C12H19NO3 and a molecular weight of 225.28 g/mol. IUPAC name: tert-butyl 3-oxo-6-azaspiro[3.4]octane-6-carboxylate. InChIKey: YSPQZAVVKDORTB-UHFFFAOYSA-N.
| Molecular formula | C12H19NO3 |
|---|---|
| Molecular weight | 225.28 g/mol |
| IUPAC name | tert-butyl 3-oxo-6-azaspiro[3.4]octane-6-carboxylate |
| InChIKey | YSPQZAVVKDORTB-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)N1CCC2(C1)CCC2=O |
Computed by PubChem (NCBI)