CAS 1087043-97-7 appears in our catalog under these names: tert-Butyl 4-ethynyl-2,2-dimethyloxazolidine-3-carboxylate, 95%, tert-Butyl 4-ethynyl-2,2-dimethyl-1,3-oxazolidine-3-carboxylate. Offered by: Combi-blocks, Biosynth. Available pack sizes: 250mg, 1g, 0,5g, 50mg.
Tert-butyl 4-ethynyl-2,2-dimethyl-1,3-oxazolidine-3-carboxylate (CAS 1087043-97-7) is a chemical compound with the molecular formula C12H19NO3 and a molecular weight of 225.28 g/mol. IUPAC name: tert-butyl 4-ethynyl-2,2-dimethyl-1,3-oxazolidine-3-carboxylate. InChIKey: DPZQSYOKTUMHNY-UHFFFAOYSA-N.
| Molecular formula | C12H19NO3 |
|---|---|
| Molecular weight | 225.28 g/mol |
| IUPAC name | tert-butyl 4-ethynyl-2,2-dimethyl-1,3-oxazolidine-3-carboxylate |
| InChIKey | DPZQSYOKTUMHNY-UHFFFAOYSA-N |
| SMILES | CC1(N(C(CO1)C#C)C(=O)OC(C)(C)C)C |
Computed by PubChem (NCBI)