CAS 1245645-37-7 appears in our catalog under these names: Cis-tert-butyl 6-acetyl-3-azabicyclo[3.1.0]hexane-3-carboxylate, 95%, cis-tert-Butyl 6-acetyl-3-azabicyclo[3.1.0]hexane-3-carboxylate 95%. Offered by: Combi-blocks, Ambeed. Available pack sizes: 100mg, 250mg, 1g, 10g, 5g.
Tert-butyl (1R,5S)-6-acetyl-3-azabicyclo[3.1.0]hexane-3-carboxylate (CAS 1245645-37-7) is a chemical compound with the molecular formula C12H19NO3 and a molecular weight of 225.28 g/mol. IUPAC name: tert-butyl (1R,5S)-6-acetyl-3-azabicyclo[3.1.0]hexane-3-carboxylate. InChIKey: ZWCSPNASTQNGJH-ULKQDVFKSA-N.
| Molecular formula | C12H19NO3 |
|---|---|
| Molecular weight | 225.28 g/mol |
| IUPAC name | tert-butyl (1R,5S)-6-acetyl-3-azabicyclo[3.1.0]hexane-3-carboxylate |
| InChIKey | ZWCSPNASTQNGJH-ULKQDVFKSA-N |
| SMILES | CC(=O)C1[C@H]2[C@@H]1CN(C2)C(=O)OC(C)(C)C |
Computed by PubChem (NCBI)