CAS 1881285-41-1 is the registry number for tert-Butyl (1s,4s)-5-oxo-2-azabicyclo[2.2.2]octane-2-carboxylate, 95%. Offered by: Combi-blocks. Available pack sizes: 100mg, 250mg, 1g.
Tert-butyl (1S,4S)-5-oxo-2-azabicyclo[2.2.2]octane-2-carboxylate (CAS 1881285-41-1) is a chemical compound with the molecular formula C12H19NO3 and a molecular weight of 225.28 g/mol. IUPAC name: tert-butyl (1S,4S)-5-oxo-2-azabicyclo[2.2.2]octane-2-carboxylate. InChIKey: AUKQEIHIPOHGHN-IUCAKERBSA-N.
| Molecular formula | C12H19NO3 |
|---|---|
| Molecular weight | 225.28 g/mol |
| IUPAC name | tert-butyl (1S,4S)-5-oxo-2-azabicyclo[2.2.2]octane-2-carboxylate |
| InChIKey | AUKQEIHIPOHGHN-IUCAKERBSA-N |
| SMILES | CC(C)(C)OC(=O)N1C[C@@H]2CC[C@H]1CC2=O |
Computed by PubChem (NCBI)