cas: 227751-84-0 — see every product listed under this CAS number, including other names
TERT-BUTYL 3-(N-METHOXY-N-METHYLCARBAMOYL)PROPYLCARBAMATE, 97% (CAS 227751-84-0) is a chemical reagent available from Chemat. Available pack sizes: 500mg, 1g, 5g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F505637-500MG |
| cas | 227751-84-0 |
| size | 500mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 500mg | 1002.79 Pln | |
| Fluorochem | 1g | 1471.37 Pln | |
| Fluorochem | 5g | 4262.06 Pln |
| purity | 97% |
|---|---|
| delivery time | 3-4 weeks |
Tert-butyl N-[4-[methoxy(methyl)amino]-4-oxobutyl]carbamate (CAS 227751-84-0) is a chemical compound with the molecular formula C11H22N2O4 and a molecular weight of 246.30 g/mol. IUPAC name: tert-butyl N-[4-[methoxy(methyl)amino]-4-oxobutyl]carbamate. InChIKey: CRDBABWMOLDZLV-UHFFFAOYSA-N.
| Molecular formula | C11H22N2O4 |
|---|---|
| Molecular weight | 246.30 g/mol |
| IUPAC name | tert-butyl N-[4-[methoxy(methyl)amino]-4-oxobutyl]carbamate |
| InChIKey | CRDBABWMOLDZLV-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)NCCCC(=O)N(C)OC |
Computed by PubChem (NCBI)