cas: 1229455-14-4 — see every product listed under this CAS number, including other names
TERT-BUTYL 4-OXO-5,7-DIHYDRO-3H-PYRROLO[3,4-D]PYRIMIDINE-6(4H)-CARBOXYLATE, 97% (CAS 1229455-14-4) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 500mg, 1g, 5g, 10g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F332426-100MG |
| cas | 1229455-14-4 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 100mg | 1330.80 Pln | |
| Fluorochem | 250mg | 2189.87 Pln | |
| Fluorochem | 500mg | 3080.18 Pln | |
| Fluorochem | 1g | 4579.66 Pln | |
| Fluorochem | 5g | 13347.40 Pln | |
| Fluorochem | 10g | 20532.37 Pln |
| purity | 97% |
|---|---|
| delivery time | 3-4 weeks |
Tert-butyl 4-oxo-5,7-dihydro-3H-pyrrolo[3,4-d]pyrimidine-6-carboxylate (CAS 1229455-14-4) is a chemical compound with the molecular formula C11H15N3O3 and a molecular weight of 237.25 g/mol. IUPAC name: tert-butyl 4-oxo-5,7-dihydro-3H-pyrrolo[3,4-d]pyrimidine-6-carboxylate. InChIKey: BXXXVYDHJCLIKQ-UHFFFAOYSA-N.
| Molecular formula | C11H15N3O3 |
|---|---|
| Molecular weight | 237.25 g/mol |
| IUPAC name | tert-butyl 4-oxo-5,7-dihydro-3H-pyrrolo[3,4-d]pyrimidine-6-carboxylate |
| InChIKey | BXXXVYDHJCLIKQ-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)N1CC2=C(C1)N=CNC2=O |
Computed by PubChem (NCBI)