cas: 1229455-14-4 — see every product listed under this CAS number, including other names
tert-Butyl 4-oxo-5,7-dihydro-3H-pyrrolo[3,4-d]pyrimidine-6(4H)-carboxylate, 97%, 97% (CAS 1229455-14-4) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 500mg, 1g, 5g, 10g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch111JSU-100mg |
| cas | 1229455-14-4 |
| size | 100mg |
| availability | 10g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 822.80 Pln | |
| Chemat | 250mg | 1336.40 Pln | |
| Chemat | 500mg | 1878.80 Pln | |
| Chemat | 1g | 2781.20 Pln | |
| Chemat | 5g | 8075.60 Pln | |
| Chemat | 10g | 12410.00 Pln |
| purity | 97% |
|---|---|
| delivery time | 3 weeks |
Tert-butyl 4-oxo-5,7-dihydro-3H-pyrrolo[3,4-d]pyrimidine-6-carboxylate (CAS 1229455-14-4) is a chemical compound with the molecular formula C11H15N3O3 and a molecular weight of 237.25 g/mol. IUPAC name: tert-butyl 4-oxo-5,7-dihydro-3H-pyrrolo[3,4-d]pyrimidine-6-carboxylate. InChIKey: BXXXVYDHJCLIKQ-UHFFFAOYSA-N.
| Molecular formula | C11H15N3O3 |
|---|---|
| Molecular weight | 237.25 g/mol |
| IUPAC name | tert-butyl 4-oxo-5,7-dihydro-3H-pyrrolo[3,4-d]pyrimidine-6-carboxylate |
| InChIKey | BXXXVYDHJCLIKQ-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)N1CC2=C(C1)N=CNC2=O |
Computed by PubChem (NCBI)