CAS 40592-88-9 appears in our catalog under these names: TLR4-IN-C34, C34, TLR4-IN-C34/ 99.77% (existing batch purity), Isopropyl 2-acetamido-3,4,6-tri-O-acetyl-2-deoxy-α-D-glucopyranoside, TLR4-IN-C34 98%. Offered by: TRC, GLPBio, TargetMol, Chemat, Biosynth. Available pack sizes: 250mg, 10mg, 25mg, 5mg, 50mg, 2mg, 100mg, 1g.
[(2R,3S,4R,5R,6S)-5-acetamido-3,4-diacetyloxy-6-propan-2-yloxyoxan-2-yl]methyl acetate (CAS 40592-88-9) is a chemical compound with the molecular formula C17H27NO9 and a molecular weight of 389.4 g/mol. IUPAC name: [(2R,3S,4R,5R,6S)-5-acetamido-3,4-diacetyloxy-6-propan-2-yloxyoxan-2-yl]methyl acetate. InChIKey: KMIQMFHPUJUDMC-HHARLNAUSA-N.
| Molecular formula | C17H27NO9 |
|---|---|
| Molecular weight | 389.4 g/mol |
| IUPAC name | [(2R,3S,4R,5R,6S)-5-acetamido-3,4-diacetyloxy-6-propan-2-yloxyoxan-2-yl]methyl acetate |
| InChIKey | KMIQMFHPUJUDMC-HHARLNAUSA-N |
| SMILES | CC(C)O[C@@H]1[C@@H]([C@H]([C@@H]([C@H](O1)COC(=O)C)OC(=O)C)OC(=O)C)NC(=O)C |
Computed by PubChem (NCBI)