cas: 78376-99-5 — see every product listed under this CAS number, including other names
TRANS-2-(TRIFLUOROMETHYL)CYCLOPROPANECARBOXYLIC ACID (CAS 78376-99-5) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F302817-100MG |
| cas | 78376-99-5 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 100mg | 1049.65 Pln | |
| Fluorochem | 250mg | 2033.68 Pln | |
| Fluorochem | 1g | 4964.94 Pln |
| delivery time | 3-4 weeks |
|---|
Trans-(1R,2R)-2-(trifluoromethyl)cyclopropane-1-carboxylic acid (CAS 78376-99-5) is a chemical compound with the molecular formula C5H5F3O2 and a molecular weight of 154.09 g/mol. IUPAC name: trans-(1R,2R)-2-(trifluoromethyl)cyclopropane-1-carboxylic acid. InChIKey: GSNLYQDUCHEFFQ-PWNYCUMCSA-N.
| Molecular formula | C5H5F3O2 |
|---|---|
| Molecular weight | 154.09 g/mol |
| IUPAC name | trans-(1R,2R)-2-(trifluoromethyl)cyclopropane-1-carboxylic acid |
| InChIKey | GSNLYQDUCHEFFQ-PWNYCUMCSA-N |
| SMILES | C1[C@H]([C@@H]1C(F)(F)F)C(=O)O |
Computed by PubChem (NCBI)