cas: 78376-99-5 — see every product listed under this CAS number, including other names
trans-2-(Trifluoromethyl)cyclopropanecarboxylic acid, 97% (CAS 78376-99-5) is a chemical reagent available from Chemat. Available pack sizes: 10g, 5g. Offered by: AmBeed.
| brand | AmBeed |
|---|---|
| catalog number | A873815-10g |
| cas | 78376-99-5 |
| size | 10g |
| availability | Synthetic Items: 0g |
| brand | size | price | |
|---|---|---|---|
| AmBeed | 10g | 32789.26 Pln | |
| AmBeed | 5g | 27112.54 Pln |
| purity | 97% |
|---|---|
| delivery time | To be confirmed by Chemat |
Trans-(1R,2R)-2-(trifluoromethyl)cyclopropane-1-carboxylic acid (CAS 78376-99-5) is a chemical compound with the molecular formula C5H5F3O2 and a molecular weight of 154.09 g/mol. IUPAC name: trans-(1R,2R)-2-(trifluoromethyl)cyclopropane-1-carboxylic acid. InChIKey: GSNLYQDUCHEFFQ-PWNYCUMCSA-N.
| Molecular formula | C5H5F3O2 |
|---|---|
| Molecular weight | 154.09 g/mol |
| IUPAC name | trans-(1R,2R)-2-(trifluoromethyl)cyclopropane-1-carboxylic acid |
| InChIKey | GSNLYQDUCHEFFQ-PWNYCUMCSA-N |
| SMILES | C1[C@H]([C@@H]1C(F)(F)F)C(=O)O |
Computed by PubChem (NCBI)