cas: 78376-99-5 — see every product listed under this CAS number, including other names
trans-2-(Trifluoromethyl)cyclopropanecarboxylic Acid, 97%, 97% (CAS 78376-99-5) is a chemical reagent available from Chemat. Available pack sizes: 50mg, 100mg, 250mg, 500mg, 1g, 5g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch11G4YO-50mg |
| cas | 78376-99-5 |
| size | 50mg |
| availability | 10g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 50mg | 429.20 Pln | |
| Chemat | 100mg | 510.80 Pln | |
| Chemat | 250mg | 813.20 Pln | |
| Chemat | 500mg | 1187.60 Pln | |
| Chemat | 1g | 1936.40 Pln | |
| Chemat | 5g | 5690.00 Pln |
| purity | 97% |
|---|---|
| delivery time | 3 weeks |
Trans-(1R,2R)-2-(trifluoromethyl)cyclopropane-1-carboxylic acid (CAS 78376-99-5) is a chemical compound with the molecular formula C5H5F3O2 and a molecular weight of 154.09 g/mol. IUPAC name: trans-(1R,2R)-2-(trifluoromethyl)cyclopropane-1-carboxylic acid. InChIKey: GSNLYQDUCHEFFQ-PWNYCUMCSA-N.
| Molecular formula | C5H5F3O2 |
|---|---|
| Molecular weight | 154.09 g/mol |
| IUPAC name | trans-(1R,2R)-2-(trifluoromethyl)cyclopropane-1-carboxylic acid |
| InChIKey | GSNLYQDUCHEFFQ-PWNYCUMCSA-N |
| SMILES | C1[C@H]([C@@H]1C(F)(F)F)C(=O)O |
Computed by PubChem (NCBI)