CAS 78376-99-5 appears in our catalog under these names: Trans-2-(trifluoromethyl)cyclopropane-1-carboxylic acid, 95%, trans-2-(Trifluoromethyl)cyclopropanecarboxylic acid, 97%, trans-2-(Trifluoromethyl)cyclopropane-1-carboxylic acid, trans-2-(Trifluoromethyl)cyclopropanecarboxylic acid 97%, trans-2-(Trifluoromethyl)cyclopropanecarboxylic Acid, 97%, 97%. Offered by: Combi-blocks, AmBeed, Biosynth, Chemat, Fluorochem. Available pack sizes: 250mg, 1g, 10g, 5g, 50mg, 0,5g, 100mg, 500mg.
Trans-(1R,2R)-2-(trifluoromethyl)cyclopropane-1-carboxylic acid (CAS 78376-99-5) is a chemical compound with the molecular formula C5H5F3O2 and a molecular weight of 154.09 g/mol. IUPAC name: trans-(1R,2R)-2-(trifluoromethyl)cyclopropane-1-carboxylic acid. InChIKey: GSNLYQDUCHEFFQ-PWNYCUMCSA-N.
| Molecular formula | C5H5F3O2 |
|---|---|
| Molecular weight | 154.09 g/mol |
| IUPAC name | trans-(1R,2R)-2-(trifluoromethyl)cyclopropane-1-carboxylic acid |
| InChIKey | GSNLYQDUCHEFFQ-PWNYCUMCSA-N |
| SMILES | C1[C@H]([C@@H]1C(F)(F)F)C(=O)O |
Computed by PubChem (NCBI)