cas: 1403767-02-1 — see every product listed under this CAS number, including other names
TRANS-3-[[(1,1-DIMETHYLETHYL)DIMETHYLSILYL]OXY]CYCLOBUTANEMETHANOL, 97% (CAS 1403767-02-1) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 500mg, 1g, 5g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F503913-100MG |
| cas | 1403767-02-1 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 100mg | 435.28 Pln | |
| Fluorochem | 250mg | 737.26 Pln | |
| Fluorochem | 500mg | 1414.10 Pln | |
| Fluorochem | 1g | 2471.02 Pln | |
| Fluorochem | 5g | 8474.12 Pln |
| purity | 97% |
|---|---|
| delivery time | 3-4 weeks |
[3-[tert-butyl(dimethyl)silyl]oxycyclobutyl]methanol (CAS 1403767-02-1) is a chemical compound with the molecular formula C11H24O2Si and a molecular weight of 216.39 g/mol. IUPAC name: [3-[tert-butyl(dimethyl)silyl]oxycyclobutyl]methanol. InChIKey: QNUGWZOQASOOEE-UHFFFAOYSA-N.
| Molecular formula | C11H24O2Si |
|---|---|
| Molecular weight | 216.39 g/mol |
| IUPAC name | [3-[tert-butyl(dimethyl)silyl]oxycyclobutyl]methanol |
| InChIKey | QNUGWZOQASOOEE-UHFFFAOYSA-N |
| SMILES | CC(C)(C)[Si](C)(C)OC1CC(C1)CO |
Computed by PubChem (NCBI)