cas: 160816-27-3 — see every product listed under this CAS number, including other names
Tert-Butyl (1-(Methoxy(Methyl)Amino)-2-Methyl-1-Oxopropan-2-Yl)Carbamate, 95%, 95% (CAS 160816-27-3) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch11AWQB-250mg |
| cas | 160816-27-3 |
| size | 250mg |
| availability | 2g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 250mg | 194.00 Pln | |
| Chemat | 1g | 328.40 Pln |
| purity | 95% |
|---|---|
| delivery time | 3 weeks |
Tert-butyl N-[1-[methoxy(methyl)amino]-2-methyl-1-oxopropan-2-yl]carbamate (CAS 160816-27-3) is a chemical compound with the molecular formula C11H22N2O4 and a molecular weight of 246.30 g/mol. IUPAC name: tert-butyl N-[1-[methoxy(methyl)amino]-2-methyl-1-oxopropan-2-yl]carbamate. InChIKey: XRIPRJRSUDUZQF-UHFFFAOYSA-N.
| Molecular formula | C11H22N2O4 |
|---|---|
| Molecular weight | 246.30 g/mol |
| IUPAC name | tert-butyl N-[1-[methoxy(methyl)amino]-2-methyl-1-oxopropan-2-yl]carbamate |
| InChIKey | XRIPRJRSUDUZQF-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)NC(C)(C)C(=O)N(C)OC |
Computed by PubChem (NCBI)