cas: 944805-17-8 — see every product listed under this CAS number, including other names
Tert-Butyl (4-Bromo-5-Formylthiazol-2-Yl)Carbamate, 98%, 98% (CAS 944805-17-8) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch11II8I-100mg |
| cas | 944805-17-8 |
| size | 100mg |
| availability | 8g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 170.00 Pln | |
| Chemat | 250mg | 213.20 Pln | |
| Chemat | 1g | 563.60 Pln | |
| Chemat | 5g | 1797.20 Pln |
| purity | 98% |
|---|---|
| delivery time | 3 weeks |
Tert-butyl N-(4-bromo-5-formyl-1,3-thiazol-2-yl)carbamate (CAS 944805-17-8) is a chemical compound with the molecular formula C9H11BrN2O3S and a molecular weight of 307.17 g/mol. IUPAC name: tert-butyl N-(4-bromo-5-formyl-1,3-thiazol-2-yl)carbamate. InChIKey: JYXJVZYNONJDLM-UHFFFAOYSA-N.
| Molecular formula | C9H11BrN2O3S |
|---|---|
| Molecular weight | 307.17 g/mol |
| IUPAC name | tert-butyl N-(4-bromo-5-formyl-1,3-thiazol-2-yl)carbamate |
| InChIKey | JYXJVZYNONJDLM-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)NC1=NC(=C(S1)C=O)Br |
Computed by PubChem (NCBI)