cas: 944805-17-8 — see every product listed under this CAS number, including other names
tert-Butyl (4-bromo-5-formylthiazol-2-yl)carbamate 95% (CAS 944805-17-8) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A213647-100mg |
| cas | 944805-17-8 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 100mg | 220.19 Pln | |
| Ambeed | 250mg | 281.38 Pln | |
| Ambeed | 1g | 748.62 Pln | |
| Ambeed | 5g | 2434.06 Pln |
| purity | 95% |
|---|---|
| delivery time | 2-3 weeks |
| ambeed catalog no. | A213647 |
Tert-butyl N-(4-bromo-5-formyl-1,3-thiazol-2-yl)carbamate (CAS 944805-17-8) is a chemical compound with the molecular formula C9H11BrN2O3S and a molecular weight of 307.17 g/mol. IUPAC name: tert-butyl N-(4-bromo-5-formyl-1,3-thiazol-2-yl)carbamate. InChIKey: JYXJVZYNONJDLM-UHFFFAOYSA-N.
| Molecular formula | C9H11BrN2O3S |
|---|---|
| Molecular weight | 307.17 g/mol |
| IUPAC name | tert-butyl N-(4-bromo-5-formyl-1,3-thiazol-2-yl)carbamate |
| InChIKey | JYXJVZYNONJDLM-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)NC1=NC(=C(S1)C=O)Br |
Computed by PubChem (NCBI)