cas: 944805-17-8 — see every product listed under this CAS number, including other names
tert-Butyl (4-bromo-5-formylthiazol-2-yl)carbamate, 98% (CAS 944805-17-8) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g, 10g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F378950-250MG |
| cas | 944805-17-8 |
| size | 250mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 250mg | 237.43 Pln | |
| Fluorochem | 1g | 529.00 Pln | |
| Fluorochem | 5g | 2382.51 Pln | |
| Fluorochem | 10g | 4699.40 Pln |
| purity | 98% |
|---|---|
| delivery time | 3-4 weeks |
Tert-butyl N-(4-bromo-5-formyl-1,3-thiazol-2-yl)carbamate (CAS 944805-17-8) is a chemical compound with the molecular formula C9H11BrN2O3S and a molecular weight of 307.17 g/mol. IUPAC name: tert-butyl N-(4-bromo-5-formyl-1,3-thiazol-2-yl)carbamate. InChIKey: JYXJVZYNONJDLM-UHFFFAOYSA-N.
| Molecular formula | C9H11BrN2O3S |
|---|---|
| Molecular weight | 307.17 g/mol |
| IUPAC name | tert-butyl N-(4-bromo-5-formyl-1,3-thiazol-2-yl)carbamate |
| InChIKey | JYXJVZYNONJDLM-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)NC1=NC(=C(S1)C=O)Br |
Computed by PubChem (NCBI)