cas: 857284-21-0 — see every product listed under this CAS number, including other names
Tert-Butyl 4-[5-(methoxycarbonyl)pyridin-2-yl]piperazine-1-carboxylate (CAS 857284-21-0) is a chemical reagent available from Chemat. Available pack sizes: 1g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch11IW0N-1g |
| cas | 857284-21-0 |
| size | 1g |
| availability | 2g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 1g | 587.60 Pln |
| delivery time | 3 weeks |
|---|
Tert-butyl 4-(5-methoxycarbonyl-2-pyridinyl)piperazine-1-carboxylate (CAS 857284-21-0) is a chemical compound with the molecular formula C16H23N3O4 and a molecular weight of 321.37 g/mol. IUPAC name: tert-butyl 4-(5-methoxycarbonyl-2-pyridinyl)piperazine-1-carboxylate. InChIKey: OOYFXPCYPUANLG-UHFFFAOYSA-N.
| Molecular formula | C16H23N3O4 |
|---|---|
| Molecular weight | 321.37 g/mol |
| IUPAC name | tert-butyl 4-(5-methoxycarbonyl-2-pyridinyl)piperazine-1-carboxylate |
| InChIKey | OOYFXPCYPUANLG-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)N1CCN(CC1)C2=NC=C(C=C2)C(=O)OC |
Computed by PubChem (NCBI)