cas: 949559-11-9 — see every product listed under this CAS number, including other names
Tert-Butyl Cis-Octahydro-1H-Pyrrolo[2,3-C]Pyridine-1-Carboxylate, 98%, 98% (CAS 949559-11-9) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g, 10g, 25g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch11IIO1-100mg |
| cas | 949559-11-9 |
| size | 100mg |
| availability | 25g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 386.00 Pln | |
| Chemat | 250mg | 486.80 Pln | |
| Chemat | 1g | 1082.00 Pln | |
| Chemat | 5g | 3438.80 Pln | |
| Chemat | 10g | 5450.00 Pln | |
| Chemat | 25g | 13408.40 Pln |
| purity | 98% |
|---|---|
| delivery time | 3 weeks |
Tert-butyl 2,3,3a,4,5,6,7,7a-octahydropyrrolo[2,3-c]pyridine-1-carboxylate (CAS 949559-11-9) is a chemical compound with the molecular formula C12H22N2O2 and a molecular weight of 226.32 g/mol. IUPAC name: tert-butyl 2,3,3a,4,5,6,7,7a-octahydropyrrolo[2,3-c]pyridine-1-carboxylate. InChIKey: KFOSBANHALBORK-UHFFFAOYSA-N.
| Molecular formula | C12H22N2O2 |
|---|---|
| Molecular weight | 226.32 g/mol |
| IUPAC name | tert-butyl 2,3,3a,4,5,6,7,7a-octahydropyrrolo[2,3-c]pyridine-1-carboxylate |
| InChIKey | KFOSBANHALBORK-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)N1CCC2C1CNCC2 |
Computed by PubChem (NCBI)