CAS 1251002-00-2 appears in our catalog under these names: 1,6-Diazaspiro[3.5]nonane-6-carboxylic acid tert-butyl ester, 95%, 1,6-Diazaspiro(3.5)nonane-6-carboxylic acid tert-butyl ester, tert-Butyl 1,6-diazaspiro[3.5]nonane-6-carboxylate 95%, tert-Butyl 1,6-diazaspiro[3.5]nonane-6-carboxylate, 97%, 97%, 6-BOC-1,6-Diazaspiro[3.5]nonane, 95%. Offered by: Combi-blocks, Biosynth, Ambeed, Chemat, Fluorochem. Available pack sizes: 250mg, 1g, 0,5g, 5g, 10g, 100mg, 500mg, 50mg.
Tert-butyl 1,8-diazaspiro[3.5]nonane-8-carboxylate (CAS 1251002-00-2) is a chemical compound with the molecular formula C12H22N2O2 and a molecular weight of 226.32 g/mol. IUPAC name: tert-butyl 1,8-diazaspiro[3.5]nonane-8-carboxylate. InChIKey: VOOWCGDOUHRBEJ-UHFFFAOYSA-N.
| Molecular formula | C12H22N2O2 |
|---|---|
| Molecular weight | 226.32 g/mol |
| IUPAC name | tert-butyl 1,8-diazaspiro[3.5]nonane-8-carboxylate |
| InChIKey | VOOWCGDOUHRBEJ-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)N1CCCC2(C1)CCN2 |
Computed by PubChem (NCBI)