cas: 263410-16-8 — see every product listed under this CAS number, including other names
Tert-butyl (2-(2-aminophenoxy)ethyl)carbamate, 97% (CAS 263410-16-8) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F725044-250MG |
| cas | 263410-16-8 |
| size | 250mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 250mg | 1101.71 Pln | |
| Fluorochem | 1g | 2497.06 Pln | |
| Fluorochem | 5g | 7339.10 Pln |
| purity | 97% |
|---|---|
| delivery time | 3-4 weeks |
Tert-butyl N-[2-(2-aminophenoxy)ethyl]carbamate (CAS 263410-16-8) is a chemical compound with the molecular formula C13H20N2O3 and a molecular weight of 252.31 g/mol. IUPAC name: tert-butyl N-[2-(2-aminophenoxy)ethyl]carbamate. InChIKey: VCJINZUTBRZEQT-UHFFFAOYSA-N.
| Molecular formula | C13H20N2O3 |
|---|---|
| Molecular weight | 252.31 g/mol |
| IUPAC name | tert-butyl N-[2-(2-aminophenoxy)ethyl]carbamate |
| InChIKey | VCJINZUTBRZEQT-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)NCCOC1=CC=CC=C1N |
Computed by PubChem (NCBI)