CAS 1824237-47-9 is the registry number for (Rac)-tert-butyl (3-carbamoylbicyclo[2.2.1]hept-5-en-2-yl)carbamate, 95%. Offered by: Combi-blocks. Available pack sizes: 250mg, 1g.
Tert-butyl N-(3-carbamoyl-2-bicyclo[2.2.1]hept-5-enyl)carbamate (CAS 1824237-47-9) is a chemical compound with the molecular formula C13H20N2O3 and a molecular weight of 252.31 g/mol. IUPAC name: tert-butyl N-(3-carbamoyl-2-bicyclo[2.2.1]hept-5-enyl)carbamate. InChIKey: DJGMHEFBXRYKPW-UHFFFAOYSA-N.
| Molecular formula | C13H20N2O3 |
|---|---|
| Molecular weight | 252.31 g/mol |
| IUPAC name | tert-butyl N-(3-carbamoyl-2-bicyclo[2.2.1]hept-5-enyl)carbamate |
| InChIKey | DJGMHEFBXRYKPW-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)NC1C2CC(C1C(=O)N)C=C2 |
Computed by PubChem (NCBI)