Products 2288709-84-0

CAS 2288709-84-0 is the registry number for tert-Butyl N-{2-[(5-methylpyridin-2-yl)oxy]ethyl}carbamate, 98%. Offered by: Combi-blocks. Available pack sizes: 5g, 1g.

Structural formula: {0} (CAS {1})

Tert-butyl N-[2-[(5-methyl-2-pyridinyl)oxy]ethyl]carbamate (CAS 2288709-84-0) is a chemical compound with the molecular formula C13H20N2O3 and a molecular weight of 252.31 g/mol. IUPAC name: tert-butyl N-[2-[(5-methyl-2-pyridinyl)oxy]ethyl]carbamate. InChIKey: IVQSKBQWVDITEZ-UHFFFAOYSA-N.

Identity
Molecular formulaC13H20N2O3
Molecular weight252.31 g/mol
IUPAC nametert-butyl N-[2-[(5-methyl-2-pyridinyl)oxy]ethyl]carbamate
InChIKeyIVQSKBQWVDITEZ-UHFFFAOYSA-N
SMILESCC1=CN=C(C=C1)OCCNC(=O)OC(C)(C)C

Computed by PubChem (NCBI)