Products 842112-53-2

CAS 842112-53-2 is the registry number for 3-(2-Cyano-acetyl)-piperidine-1-carboxylic acid tert-butyl ester, 95%. Offered by: Combi-blocks. Available pack sizes: 5g, 250mg, 1g.

Structural formula: {0} (CAS {1})

Tert-butyl 3-(2-cyanoacetyl)piperidine-1-carboxylate (CAS 842112-53-2) is a chemical compound with the molecular formula C13H20N2O3 and a molecular weight of 252.31 g/mol. IUPAC name: tert-butyl 3-(2-cyanoacetyl)piperidine-1-carboxylate. InChIKey: JAZKIHRZCJYSKE-UHFFFAOYSA-N.

Identity
Molecular formulaC13H20N2O3
Molecular weight252.31 g/mol
IUPAC nametert-butyl 3-(2-cyanoacetyl)piperidine-1-carboxylate
InChIKeyJAZKIHRZCJYSKE-UHFFFAOYSA-N
SMILESCC(C)(C)OC(=O)N1CCCC(C1)C(=O)CC#N

Computed by PubChem (NCBI)