CAS 2088-71-3 appears in our catalog under these names: Testosterone Benzoate (1.0 mg/mL in Acetonitrile), Testosterone Benzoate, Testosterone Benzoate 1.0 mg/ml in Acetonitrile. Offered by: TRC, Mikromol, LoGiCal, Biosynth, HPC Standards. Available pack sizes: 10x1ml, 100mg, 250mg, 50mg, 10mg, 1ml, 500mg, 1x10mg.
[(8R,9S,10R,13S,14S,17S)-10,13-dimethyl-3-oxo-1,2,6,7,8,9,11,12,14,15,16,17-dodecahydrocyclopenta[a]phenanthren-17-yl] benzoate (CAS 2088-71-3) is a chemical compound with the molecular formula C26H32O3 and a molecular weight of 392.5 g/mol. IUPAC name: [(8R,9S,10R,13S,14S,17S)-10,13-dimethyl-3-oxo-1,2,6,7,8,9,11,12,14,15,16,17-dodecahydrocyclopenta[a]phenanthren-17-yl] benzoate. InChIKey: RZJSCADWIWNGKI-IXKNJLPQSA-N.
| Molecular formula | C26H32O3 |
|---|---|
| Molecular weight | 392.5 g/mol |
| IUPAC name | [(8R,9S,10R,13S,14S,17S)-10,13-dimethyl-3-oxo-1,2,6,7,8,9,11,12,14,15,16,17-dodecahydrocyclopenta[a]phenanthren-17-yl] benzoate |
| InChIKey | RZJSCADWIWNGKI-IXKNJLPQSA-N |
| SMILES | C[C@]12CC[C@H]3[C@H]([C@@H]1CC[C@@H]2OC(=O)C4=CC=CC=C4)CCC5=CC(=O)CC[C@]35C |
Computed by PubChem (NCBI)