cas: 835616-61-0 — see every product listed under this CAS number, including other names
Thalidomide 5-fluoride 97% (CAS 835616-61-0) is a chemical reagent available from Chemat. Available pack sizes: 1000g, 250mg, 1g, 5g, 10g, 25g, 100g, 500g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A1004509-1000g |
| cas | 835616-61-0 |
| size | 1000g |
Ask us about this product — we're happy to help.
| brand | size | price | |
|---|---|---|---|
| Ambeed | 1000g | 18170.38 Pln | |
| Ambeed | 250mg | 120.06 Pln | |
| Ambeed | 1g | 147.88 Pln | |
| Ambeed | 5g | 236.88 Pln | |
| Ambeed | 10g | 381.50 Pln | |
| Ambeed | 25g | 804.25 Pln | |
| Ambeed | 100g | 2895.75 Pln | |
| Ambeed | 500g | 11384.12 Pln |
| purity | 97% |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A1004509 |
2-(2,6-dioxopiperidin-3-yl)-5-fluoroisoindole-1,3-dione (CAS 835616-61-0) is a chemical compound with the molecular formula C13H9FN2O4 and a molecular weight of 276.22 g/mol. IUPAC name: 2-(2,6-dioxopiperidin-3-yl)-5-fluoroisoindole-1,3-dione. InChIKey: MPQLCQKBYRSPNA-UHFFFAOYSA-N.
| Molecular formula | C13H9FN2O4 |
|---|---|
| Molecular weight | 276.22 g/mol |
| IUPAC name | 2-(2,6-dioxopiperidin-3-yl)-5-fluoroisoindole-1,3-dione |
| InChIKey | MPQLCQKBYRSPNA-UHFFFAOYSA-N |
| SMILES | C1CC(=O)NC(=O)C1N2C(=O)C3=C(C2=O)C=C(C=C3)F |
Computed by PubChem (NCBI)