CAS 911109-85-8 appears in our catalog under these names: (S)-2-(2,6-Dioxopiperidin-3-yl)-4-fluoroisoindoline-1,3-dione, 98%, 98%, 2-[(3S)-2,6-Dioxo-3-piperidinyl]-4-fluoro-1H-isoindole-1,3(2H)-dione, 98%. Offered by: Chemat, Fluorochem. Available pack sizes: 100mg.
2-[(3S)-2,6-dioxopiperidin-3-yl]-4-fluoroisoindole-1,3-dione (CAS 911109-85-8) is a chemical compound with the molecular formula C13H9FN2O4 and a molecular weight of 276.22 g/mol. IUPAC name: 2-[(3S)-2,6-dioxopiperidin-3-yl]-4-fluoroisoindole-1,3-dione. InChIKey: CRAUTELYXAAAPW-QMMMGPOBSA-N.
| Molecular formula | C13H9FN2O4 |
|---|---|
| Molecular weight | 276.22 g/mol |
| IUPAC name | 2-[(3S)-2,6-dioxopiperidin-3-yl]-4-fluoroisoindole-1,3-dione |
| InChIKey | CRAUTELYXAAAPW-QMMMGPOBSA-N |
| SMILES | C1CC(=O)NC(=O)[C@H]1N2C(=O)C3=C(C2=O)C(=CC=C3)F |
Computed by PubChem (NCBI)