CAS 835616-61-0 appears in our catalog under these names: 2-(2,6-Dioxopiperidin-3-yl)-5-fluoroisoindoline-1,3-dione, 98%, Thalidomide 5–fluoride, Thalidomide 5-fluoride/ 98.62% (existing batch purity), Thalidomide 5-fluoride, 2-(2,6-Dioxopiperidin-3-yl)-5-fluoroisoindoline-1,3-dione, >98.0%(HPLC)(T). Offered by: Combi-blocks, GLPBio, TargetMol, Biosynth, TCI. Available pack sizes: 1g, 25g, 10g, 5g, 100mg, 250mg, 500mg, 100g.
2-(2,6-dioxopiperidin-3-yl)-5-fluoroisoindole-1,3-dione (CAS 835616-61-0) is a chemical compound with the molecular formula C13H9FN2O4 and a molecular weight of 276.22 g/mol. IUPAC name: 2-(2,6-dioxopiperidin-3-yl)-5-fluoroisoindole-1,3-dione. InChIKey: MPQLCQKBYRSPNA-UHFFFAOYSA-N.
| Molecular formula | C13H9FN2O4 |
|---|---|
| Molecular weight | 276.22 g/mol |
| IUPAC name | 2-(2,6-dioxopiperidin-3-yl)-5-fluoroisoindole-1,3-dione |
| InChIKey | MPQLCQKBYRSPNA-UHFFFAOYSA-N |
| SMILES | C1CC(=O)NC(=O)C1N2C(=O)C3=C(C2=O)C=C(C=C3)F |
Computed by PubChem (NCBI)