CAS 2243823-26-7 appears in our catalog under these names: (R)-2-(2,6-Dioxopiperidin-3-yl)-4-fluoroisoindoline-1,3-dione, 97%, (R)-2-(2,6-Dioxopiperidin-3-yl)-4-fluoroisoindoline-1,3-dione, 98%, 98%, (R)-2-(2,6-Dioxopiperidin-3-yl)-4-fluoroisoindoline-1,3-dione, 98%. Offered by: Chemat Brand, Chemat, Fluorochem. Available pack sizes: on request, 100mg, 250mg, 1g, 25mg.
2-[(3R)-2,6-dioxopiperidin-3-yl]-4-fluoroisoindole-1,3-dione (CAS 2243823-26-7) is a chemical compound with the molecular formula C13H9FN2O4 and a molecular weight of 276.22 g/mol. IUPAC name: 2-[(3R)-2,6-dioxopiperidin-3-yl]-4-fluoroisoindole-1,3-dione. InChIKey: CRAUTELYXAAAPW-MRVPVSSYSA-N.
| Molecular formula | C13H9FN2O4 |
|---|---|
| Molecular weight | 276.22 g/mol |
| IUPAC name | 2-[(3R)-2,6-dioxopiperidin-3-yl]-4-fluoroisoindole-1,3-dione |
| InChIKey | CRAUTELYXAAAPW-MRVPVSSYSA-N |
| SMILES | C1CC(=O)NC(=O)[C@@H]1N2C(=O)C3=C(C2=O)C(=CC=C3)F |
Computed by PubChem (NCBI)