cas: 59944-79-5 — see every product listed under this CAS number, including other names
Thieno[2,3-b]pyrazine-6-carboxylic acid 95+% (CAS 59944-79-5) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A103385-100mg |
| cas | 59944-79-5 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 100mg | 331.44 Pln | |
| Ambeed | 250mg | 542.81 Pln | |
| Ambeed | 1g | 1327.12 Pln | |
| Ambeed | 5g | 4286.38 Pln |
| purity | 95+% |
|---|---|
| delivery time | 2-3 weeks |
| ambeed catalog no. | A103385 |
Thieno[2,3-b]pyrazine-6-carboxylic acid (CAS 59944-79-5) is a chemical compound with the molecular formula C7H4N2O2S and a molecular weight of 180.19 g/mol. IUPAC name: thieno[2,3-b]pyrazine-6-carboxylic acid. InChIKey: MEHCDDSVVYRWJT-UHFFFAOYSA-N.
| Molecular formula | C7H4N2O2S |
|---|---|
| Molecular weight | 180.19 g/mol |
| IUPAC name | thieno[2,3-b]pyrazine-6-carboxylic acid |
| InChIKey | MEHCDDSVVYRWJT-UHFFFAOYSA-N |
| SMILES | C1=CN=C2C(=N1)C=C(S2)C(=O)O |
Computed by PubChem (NCBI)