CAS 3529-82-6 appears in our catalog under these names: 3-Nitrophenyl isothiocyanate, 97%, 3–Nitrophenyl isothiocyanate, 3-Nitrophenyl isothiocyanate, 1-Isothiocyanato-3-nitrobenzene, >98.0%(GC), 3-NITROPHENYL ISOTHIOCYANATE, 98%. Offered by: Combi-blocks, GLPBio, Biosynth, TCI, Sigma-Aldrich. Available pack sizes: 25g, 5g, 100g, 1g, 10g.
1-isothiocyanato-3-nitrobenzene (CAS 3529-82-6) is a chemical compound with the molecular formula C7H4N2O2S and a molecular weight of 180.19 g/mol. IUPAC name: 1-isothiocyanato-3-nitrobenzene. InChIKey: OEZXLKSZOAWNJU-UHFFFAOYSA-N.
| Molecular formula | C7H4N2O2S |
|---|---|
| Molecular weight | 180.19 g/mol |
| IUPAC name | 1-isothiocyanato-3-nitrobenzene |
| InChIKey | OEZXLKSZOAWNJU-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC(=C1)[N+](=O)[O-])N=C=S |
Computed by PubChem (NCBI)