CAS 59944-79-5 appears in our catalog under these names: Thieno[2,3-b]pyrazine-6-carboxylic acid, 95%, Thieno[2,3-b]pyrazine-6-carboxylic acid, 90% , Thieno[2,3-b]pyrazine-6-carboxylic acid 95+%, Thieno[2,3-b]pyrazine-6-carboxylic acid, 95+%, 95+%, Thieno[2,3-b]pyrazine-6-carboxylic acid, 95+%. Offered by: Combi-blocks, Thermo Scientific, Ambeed, Chemat, Fluorochem. Available pack sizes: 1g, 250MG, 100mg, 5g, 500mg.
Thieno[2,3-b]pyrazine-6-carboxylic acid (CAS 59944-79-5) is a chemical compound with the molecular formula C7H4N2O2S and a molecular weight of 180.19 g/mol. IUPAC name: thieno[2,3-b]pyrazine-6-carboxylic acid. InChIKey: MEHCDDSVVYRWJT-UHFFFAOYSA-N.
| Molecular formula | C7H4N2O2S |
|---|---|
| Molecular weight | 180.19 g/mol |
| IUPAC name | thieno[2,3-b]pyrazine-6-carboxylic acid |
| InChIKey | MEHCDDSVVYRWJT-UHFFFAOYSA-N |
| SMILES | C1=CN=C2C(=N1)C=C(S2)C(=O)O |
Computed by PubChem (NCBI)