CAS 3529-57-5 appears in our catalog under these names: 2,1,3-Benzothiadiazole-4-carboxylic acid, 95%, 2,1,3-Benzothiadiazole-4-carboxylic Acid, 2,1,3-Benzothiadiazole-4-carboxylic acid, 97% , Benzo[c][1,2,5]thiadiazole-4-carboxylic acid 95+%, Benzo[c][1,2,5]thiadiazole-4-carboxylic acid, 95%, 95%. Offered by: Combi-blocks, TRC, Thermo Scientific, Ambeed, Chemat. Available pack sizes: 100mg, 1g, 250MG, 5g.
2,1,3-benzothiadiazole-4-carboxylic acid (CAS 3529-57-5) is a chemical compound with the molecular formula C7H4N2O2S and a molecular weight of 180.19 g/mol. IUPAC name: 2,1,3-benzothiadiazole-4-carboxylic acid. InChIKey: ZGDGZMOKXTUMEV-UHFFFAOYSA-N.
| Molecular formula | C7H4N2O2S |
|---|---|
| Molecular weight | 180.19 g/mol |
| IUPAC name | 2,1,3-benzothiadiazole-4-carboxylic acid |
| InChIKey | ZGDGZMOKXTUMEV-UHFFFAOYSA-N |
| SMILES | C1=CC2=NSN=C2C(=C1)C(=O)O |
Computed by PubChem (NCBI)