cas: 1033366-59-4 — see every product listed under this CAS number, including other names
Thieno[2,3-d]pyrimidin-2(1H)-one, 4-amino-5,6-dimethyl-, hydrochloride (1:1), 95%, 95% (CAS 1033366-59-4) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g, 10g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch114AF7-1g |
| cas | 1033366-59-4 |
| size | 1g |
| availability | 20g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 1g | 405.20 Pln | |
| Chemat | 5g | 1096.40 Pln | |
| Chemat | 10g | 1782.80 Pln |
| purity | 95% |
|---|---|
| delivery time | 3 weeks |
4-amino-5,6-dimethyl-3H-thieno[2,3-d]pyrimidin-2-one;hydrochloride (CAS 1033366-59-4) is a chemical compound with the molecular formula C8H10ClN3OS and a molecular weight of 231.70 g/mol. IUPAC name: 4-amino-5,6-dimethyl-3H-thieno[2,3-d]pyrimidin-2-one;hydrochloride. InChIKey: NHYFUIDCZUDTSL-UHFFFAOYSA-N.
| Molecular formula | C8H10ClN3OS |
|---|---|
| Molecular weight | 231.70 g/mol |
| IUPAC name | 4-amino-5,6-dimethyl-3H-thieno[2,3-d]pyrimidin-2-one;hydrochloride |
| InChIKey | NHYFUIDCZUDTSL-UHFFFAOYSA-N |
| SMILES | CC1=C(SC2=NC(=O)NC(=C12)N)C.Cl |
Computed by PubChem (NCBI)