CAS 923216-51-7 appears in our catalog under these names: 2-[(Methylamino)methyl]thieno[3,2-d]pyrimidin-4(3h)-one hydrochloride, 97%, 2-((Methylamino)methyl)thieno(3,2-d)pyrimidin-4(3h)-one HCl. Offered by: Combi-blocks, Biosynth. Available pack sizes: 1g, 250mg, 100mg, 2,5g.
2-(methylaminomethyl)-3H-thieno[3,2-d]pyrimidin-4-one;hydrochloride (CAS 923216-51-7) is a chemical compound with the molecular formula C8H10ClN3OS and a molecular weight of 231.70 g/mol. IUPAC name: 2-(methylaminomethyl)-3H-thieno[3,2-d]pyrimidin-4-one;hydrochloride. InChIKey: SEVCRTKXDVMDSU-UHFFFAOYSA-N.
| Molecular formula | C8H10ClN3OS |
|---|---|
| Molecular weight | 231.70 g/mol |
| IUPAC name | 2-(methylaminomethyl)-3H-thieno[3,2-d]pyrimidin-4-one;hydrochloride |
| InChIKey | SEVCRTKXDVMDSU-UHFFFAOYSA-N |
| SMILES | CNCC1=NC2=C(C(=O)N1)SC=C2.Cl |
Computed by PubChem (NCBI)