CAS 1609395-80-3 is the registry number for ([5-(2-Thienylmethyl)-1,2,4-oxadiazol-3-yl]methyl)amine hydrochloride, 95%. Offered by: Combi-blocks. Available pack sizes: 5g, 250mg, 1g.
[5-(thiophen-2-ylmethyl)-1,2,4-oxadiazol-3-yl]methanamine;hydrochloride (CAS 1609395-80-3) is a chemical compound with the molecular formula C8H10ClN3OS and a molecular weight of 231.70 g/mol. IUPAC name: [5-(thiophen-2-ylmethyl)-1,2,4-oxadiazol-3-yl]methanamine;hydrochloride. InChIKey: GZFKRPFLPCCLQS-UHFFFAOYSA-N.
| Molecular formula | C8H10ClN3OS |
|---|---|
| Molecular weight | 231.70 g/mol |
| IUPAC name | [5-(thiophen-2-ylmethyl)-1,2,4-oxadiazol-3-yl]methanamine;hydrochloride |
| InChIKey | GZFKRPFLPCCLQS-UHFFFAOYSA-N |
| SMILES | C1=CSC(=C1)CC2=NC(=NO2)CN.Cl |
Computed by PubChem (NCBI)