Products 878668-04-3
CAS 878668-04-3 is the registry number for 2-Chloro-n-(5-cyclobutyl-1,3,4-thiadiazol-2-yl)acetamide, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 5g.
2-chloro-N-(5-cyclobutyl-1,3,4-thiadiazol-2-yl)acetamide (CAS 878668-04-3) is a chemical compound with the molecular formula C8H10ClN3OS and a molecular weight of 231.70 g/mol. IUPAC name: 2-chloro-N-(5-cyclobutyl-1,3,4-thiadiazol-2-yl)acetamide. InChIKey: JTFYPGWANGGREM-UHFFFAOYSA-N.
| Molecular formula | C8H10ClN3OS |
|---|---|
| Molecular weight | 231.70 g/mol |
| IUPAC name | 2-chloro-N-(5-cyclobutyl-1,3,4-thiadiazol-2-yl)acetamide |
| InChIKey | JTFYPGWANGGREM-UHFFFAOYSA-N |
| SMILES | C1CC(C1)C2=NN=C(S2)NC(=O)CCl |
Computed by PubChem (NCBI)