cas: 401485-19-6 — see every product listed under this CAS number, including other names
Thiophen-2-ylmethyl-carbamic acid tert-butyl ester, 95% (CAS 401485-19-6) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F736146-1G |
| cas | 401485-19-6 |
| size | 1g |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 1g | 310.33 Pln | |
| Fluorochem | 5g | 841.39 Pln |
| purity | 95% |
|---|---|
| delivery time | 3-4 weeks |
Tert-butyl N-(thiophen-2-ylmethyl)carbamate (CAS 401485-19-6) is a chemical compound with the molecular formula C10H15NO2S and a molecular weight of 213.30 g/mol. IUPAC name: tert-butyl N-(thiophen-2-ylmethyl)carbamate. InChIKey: PJYFEMRXRXRMSS-UHFFFAOYSA-N.
| Molecular formula | C10H15NO2S |
|---|---|
| Molecular weight | 213.30 g/mol |
| IUPAC name | tert-butyl N-(thiophen-2-ylmethyl)carbamate |
| InChIKey | PJYFEMRXRXRMSS-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)NCC1=CC=CS1 |
Computed by PubChem (NCBI)